C30H27F4NO4 — CID 58887631
ethyl 3-acetamido-5-[2-[2-[(4-fluorophenyl)methoxy]-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzoate (PubChem CID 58887631) has the molecular formula C30H27F4NO4 and a molecular weight of 541.54 g/mol. Its IUPAC name is ethyl 3-acetamido-5-[2-[2-[(4-fluorophenyl)methoxy]-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzoate.
| Compound Name | ethyl 3-acetamido-5-[2-[2-[(4-fluorophenyl)methoxy]-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzoate |
|---|---|
| PubChem CID | 58887631 |
| Molecular Formula | C30H27F4NO4 |
| Molecular Weight | 541.54 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | ethyl 3-acetamido-5-[2-[2-[(4-fluorophenyl)methoxy]-5-(trifluoromethyl)phenyl]cyclopenten-1-yl]benzoate |
| SMILES | CCOC(=O)c1cc(NC(C)=O)cc(C2=C(c3cc(C(F)(F)F)ccc3OCc3ccc(F)cc3)CCC2)c1 |
| InChI | InChI=1S/C30H27F4NO4/c1-3-38-29(37)21-13-20(14-24(15-21)35-18(2)36)25-5-4-6-26(25)27-16-22(30(32,33)34)9-12-28(27)39-17-19-7-10-23(31)11-8-19/h7-16H,3-6,17H2,1-2H3,(H,35,36) |
| InChIKey | QIGKJFQLSYBZFW-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.54 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|