C26H22ClF2NO3 — CID 91332984
methyl 3-amino-5-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoate (PubChem CID 91332984) has the molecular formula C26H22ClF2NO3 and a molecular weight of 469.92 g/mol. Its IUPAC name is methyl 3-amino-5-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoate.
| Compound Name | methyl 3-amino-5-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoate |
|---|---|
| PubChem CID | 91332984 |
| Molecular Formula | C26H22ClF2NO3 |
| Molecular Weight | 469.92 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | methyl 3-amino-5-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]benzoate |
| SMILES | COC(=O)c1cc(N)cc(C2=C(c3cc(Cl)ccc3OCc3ccc(F)cc3F)CCC2)c1 |
| InChI | InChI=1S/C26H22ClF2NO3/c1-32-26(31)17-9-16(10-20(30)11-17)21-3-2-4-22(21)23-12-18(27)6-8-25(23)33-14-15-5-7-19(28)13-24(15)29/h5-13H,2-4,14,30H2,1H3 |
| InChIKey | AWBUPIZTEFKZDP-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.92 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|