C24H21ClFN2O3+ — CID 146757698
amino 6-[2-[2-[(4-chlorophenyl)methoxy]-5-fluorophenyl]cyclopenten-1-yl]pyridin-1-ium-2-carboxylate (PubChem CID 146757698) has the molecular formula C24H21ClFN2O3+ and a molecular weight of 439.89 g/mol. Its IUPAC name is amino 6-[2-[2-[(4-chlorophenyl)methoxy]-5-fluorophenyl]cyclopenten-1-yl]pyridin-1-ium-2-carboxylate.
| Compound Name | amino 6-[2-[2-[(4-chlorophenyl)methoxy]-5-fluorophenyl]cyclopenten-1-yl]pyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 146757698 |
| Molecular Formula | C24H21ClFN2O3+ |
| Molecular Weight | 439.89 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | amino 6-[2-[2-[(4-chlorophenyl)methoxy]-5-fluorophenyl]cyclopenten-1-yl]pyridin-1-ium-2-carboxylate |
| SMILES | NOC(=O)c1cccc(C2=C(c3cc(F)ccc3OCc3ccc(Cl)cc3)CCC2)[nH+]1 |
| InChI | InChI=1S/C24H20ClFN2O3/c25-16-9-7-15(8-10-16)14-30-23-12-11-17(26)13-20(23)18-3-1-4-19(18)21-5-2-6-22(28-21)24(29)31-27/h2,5-13H,1,3-4,14,27H2/p+1 |
| InChIKey | DWSLLLWSBBMWGH-UHFFFAOYSA-O |
| XLogP | 5.00 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.89 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|