C23H19Cl2NO — CID 91031962
2-[2-[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]cyclopenten-1-yl]pyridine (PubChem CID 91031962) has the molecular formula C23H19Cl2NO and a molecular weight of 396.32 g/mol. Its IUPAC name is 2-[2-[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]cyclopenten-1-yl]pyridine.
| Compound Name | 2-[2-[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]cyclopenten-1-yl]pyridine |
|---|---|
| PubChem CID | 91031962 |
| Molecular Formula | C23H19Cl2NO |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 2-[2-[5-chloro-2-[(4-chlorophenyl)methoxy]phenyl]cyclopenten-1-yl]pyridine |
| SMILES | Clc1ccc(COc2ccc(Cl)cc2C2=C(c3ccccn3)CCC2)cc1 |
| InChI | InChI=1S/C23H19Cl2NO/c24-17-9-7-16(8-10-17)15-27-23-12-11-18(25)14-21(23)19-4-3-5-20(19)22-6-1-2-13-26-22/h1-2,6-14H,3-5,15H2 |
| InChIKey | YZPPPSSMYGCTLM-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |