C25H21ClNNaO3 — CID 59808916
sodium 6-[2-(5-chloro-2-phenylmethoxyphenyl)cyclohexen-1-yl]pyridine-2-carboxylate (PubChem CID 59808916) has the molecular formula C25H21ClNNaO3 and a molecular weight of 441.89 g/mol. Its IUPAC name is sodium 6-[2-(5-chloro-2-phenylmethoxyphenyl)cyclohexen-1-yl]pyridine-2-carboxylate.
| Compound Name | sodium 6-[2-(5-chloro-2-phenylmethoxyphenyl)cyclohexen-1-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 59808916 |
| Molecular Formula | C25H21ClNNaO3 |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | sodium 6-[2-(5-chloro-2-phenylmethoxyphenyl)cyclohexen-1-yl]pyridine-2-carboxylate |
| SMILES | O=C([O-])c1cccc(C2=C(c3cc(Cl)ccc3OCc3ccccc3)CCCC2)n1.[Na+] |
| InChI | InChI=1S/C25H22ClNO3.Na/c26-18-13-14-24(30-16-17-7-2-1-3-8-17)21(15-18)19-9-4-5-10-20(19)22-11-6-12-23(27-22)25(28)29;/h1-3,6-8,11-15H,4-5,9-10,16H2,(H,28,29);/q;+1/p-1 |
| InChIKey | PSFQGTPADGEQGS-UHFFFAOYSA-M |
| XLogP | 2.17 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |