C24H19ClNO3- — CID 58974040
6-[2-[5-chloro-2-(cyclopenten-1-ylmethoxy)phenyl]phenyl]pyridine-2-carboxylate (PubChem CID 58974040) has the molecular formula C24H19ClNO3- and a molecular weight of 404.87 g/mol. Its IUPAC name is 6-[2-[5-chloro-2-(cyclopenten-1-ylmethoxy)phenyl]phenyl]pyridine-2-carboxylate.
| Compound Name | 6-[2-[5-chloro-2-(cyclopenten-1-ylmethoxy)phenyl]phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 58974040 |
| Molecular Formula | C24H19ClNO3- |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 6-[2-[5-chloro-2-(cyclopenten-1-ylmethoxy)phenyl]phenyl]pyridine-2-carboxylate |
| SMILES | O=C([O-])c1cccc(-c2ccccc2-c2cc(Cl)ccc2OCC2=CCCC2)n1 |
| InChI | InChI=1S/C24H20ClNO3/c25-17-12-13-23(29-15-16-6-1-2-7-16)20(14-17)18-8-3-4-9-19(18)21-10-5-11-22(26-21)24(27)28/h3-6,8-14H,1-2,7,15H2,(H,27,28)/p-1 |
| InChIKey | UMMVPWFABQDOSP-UHFFFAOYSA-M |
| XLogP | 4.92 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|