C25H26ClNO3 — CID 58974061
ethyl 6-[2-[5-chloro-2-(3-methylbutoxy)phenyl]phenyl]pyridine-2-carboxylate (PubChem CID 58974061) has the molecular formula C25H26ClNO3 and a molecular weight of 423.94 g/mol. Its IUPAC name is ethyl 6-[2-[5-chloro-2-(3-methylbutoxy)phenyl]phenyl]pyridine-2-carboxylate.
| Compound Name | ethyl 6-[2-[5-chloro-2-(3-methylbutoxy)phenyl]phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 58974061 |
| Molecular Formula | C25H26ClNO3 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | ethyl 6-[2-[5-chloro-2-(3-methylbutoxy)phenyl]phenyl]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cccc(-c2ccccc2-c2cc(Cl)ccc2OCCC(C)C)n1 |
| InChI | InChI=1S/C25H26ClNO3/c1-4-29-25(28)23-11-7-10-22(27-23)20-9-6-5-8-19(20)21-16-18(26)12-13-24(21)30-15-14-17(2)3/h5-13,16-17H,4,14-15H2,1-3H3 |
| InChIKey | NKPDXHSGVXRBAR-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |