C25H24ClNO3 — CID 58974058
ethyl 6-[2-[5-chloro-2-[(E)-2-methylbut-2-enoxy]phenyl]phenyl]pyridine-2-carboxylate (PubChem CID 58974058) has the molecular formula C25H24ClNO3 and a molecular weight of 421.92 g/mol. Its IUPAC name is ethyl 6-[2-[5-chloro-2-[(E)-2-methylbut-2-enoxy]phenyl]phenyl]pyridine-2-carboxylate.
| Compound Name | ethyl 6-[2-[5-chloro-2-[(E)-2-methylbut-2-enoxy]phenyl]phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 58974058 |
| Molecular Formula | C25H24ClNO3 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | ethyl 6-[2-[5-chloro-2-[(E)-2-methylbut-2-enoxy]phenyl]phenyl]pyridine-2-carboxylate |
| SMILES | C/C=C(\C)COc1ccc(Cl)cc1-c1ccccc1-c1cccc(C(=O)OCC)n1 |
| InChI | InChI=1S/C25H24ClNO3/c1-4-17(3)16-30-24-14-13-18(26)15-21(24)19-9-6-7-10-20(19)22-11-8-12-23(27-22)25(28)29-5-2/h4,6-15H,5,16H2,1-3H3/b17-4+ |
| InChIKey | GERVMUSZNHHQJY-HAVNEIBRSA-N |
| XLogP | 6.59 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|