C26H21ClF2N2O3 — CID 58838259
ethyl 6-[2-[5-chloro-2-[(2,5-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]pyridine-2-carboxylate (PubChem CID 58838259) has the molecular formula C26H21ClF2N2O3 and a molecular weight of 482.91 g/mol. Its IUPAC name is ethyl 6-[2-[5-chloro-2-[(2,5-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]pyridine-2-carboxylate.
| Compound Name | ethyl 6-[2-[5-chloro-2-[(2,5-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 58838259 |
| Molecular Formula | C26H21ClF2N2O3 |
| Molecular Weight | 482.91 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | ethyl 6-[2-[5-chloro-2-[(2,5-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cccc(-n2c(C)ccc2-c2cc(Cl)ccc2OCc2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C26H21ClF2N2O3/c1-3-33-26(32)22-5-4-6-25(30-22)31-16(2)7-11-23(31)20-14-18(27)8-12-24(20)34-15-17-13-19(28)9-10-21(17)29/h4-14H,3,15H2,1-2H3 |
| InChIKey | CMFCPNSIMHTTBD-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.91 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|