C27H21BrF3NO3 — CID 58854461
ethyl 3-[2-[5-bromo-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]benzoate (PubChem CID 58854461) has the molecular formula C27H21BrF3NO3 and a molecular weight of 544.37 g/mol. Its IUPAC name is ethyl 3-[2-[5-bromo-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 3-[2-[5-bromo-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 58854461 |
| Molecular Formula | C27H21BrF3NO3 |
| Molecular Weight | 544.37 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | ethyl 3-[2-[5-bromo-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-n2c(C)ccc2-c2cc(Br)ccc2OCc2cc(F)c(F)cc2F)c1 |
| InChI | InChI=1S/C27H21BrF3NO3/c1-3-34-27(33)17-5-4-6-20(11-17)32-16(2)7-9-25(32)21-13-19(28)8-10-26(21)35-15-18-12-23(30)24(31)14-22(18)29/h4-14H,3,15H2,1-2H3 |
| InChIKey | QPORILYOKZROFZ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.37 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|