C28H23ClF3NO3 — CID 58854293
ethyl 3-[2-[2-[(4-chlorophenyl)methoxy]-5-(trifluoromethyl)phenyl]-5-methylpyrrol-1-yl]benzoate (PubChem CID 58854293) has the molecular formula C28H23ClF3NO3 and a molecular weight of 513.94 g/mol. Its IUPAC name is ethyl 3-[2-[2-[(4-chlorophenyl)methoxy]-5-(trifluoromethyl)phenyl]-5-methylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 3-[2-[2-[(4-chlorophenyl)methoxy]-5-(trifluoromethyl)phenyl]-5-methylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 58854293 |
| Molecular Formula | C28H23ClF3NO3 |
| Molecular Weight | 513.94 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | ethyl 3-[2-[2-[(4-chlorophenyl)methoxy]-5-(trifluoromethyl)phenyl]-5-methylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-n2c(C)ccc2-c2cc(C(F)(F)F)ccc2OCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C28H23ClF3NO3/c1-3-35-27(34)20-5-4-6-23(15-20)33-18(2)7-13-25(33)24-16-21(28(30,31)32)10-14-26(24)36-17-19-8-11-22(29)12-9-19/h4-16H,3,17H2,1-2H3 |
| InChIKey | JDYLKKBSLSEFSD-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.94 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|