C28H28FNO3 — CID 142835437
ethane;3-[2-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]-5-methylpyrrol-1-yl]benzoic acid (PubChem CID 142835437) has the molecular formula C28H28FNO3 and a molecular weight of 445.53 g/mol. Its IUPAC name is ethane;3-[2-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]-5-methylpyrrol-1-yl]benzoic acid.
| Compound Name | ethane;3-[2-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]-5-methylpyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 142835437 |
| Molecular Formula | C28H28FNO3 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | ethane;3-[2-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]-5-methylpyrrol-1-yl]benzoic acid |
| SMILES | CC.Cc1ccc(OCc2ccc(F)cc2)c(-c2ccc(C)n2-c2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C26H22FNO3.C2H6/c1-17-6-13-25(31-16-19-8-10-21(27)11-9-19)23(14-17)24-12-7-18(2)28(24)22-5-3-4-20(15-22)26(29)30;1-2/h3-15H,16H2,1-2H3,(H,29,30);1-2H3 |
| InChIKey | ALFWHRTWFIEGAW-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|