C28H28BrFN2O3 — CID 142834988
3-amino-5-[2-[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-methylbenzoic acid;ethane (PubChem CID 142834988) has the molecular formula C28H28BrFN2O3 and a molecular weight of 539.45 g/mol. Its IUPAC name is 3-amino-5-[2-[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-methylbenzoic acid;ethane.
| Compound Name | 3-amino-5-[2-[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-methylbenzoic acid;ethane |
|---|---|
| PubChem CID | 142834988 |
| Molecular Formula | C28H28BrFN2O3 |
| Molecular Weight | 539.45 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 3-amino-5-[2-[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-methylbenzoic acid;ethane |
| SMILES | CC.Cc1c(N)cc(-n2c(C)ccc2-c2cc(Br)ccc2OCc2ccc(F)cc2)cc1C(=O)O |
| InChI | InChI=1S/C26H22BrFN2O3.C2H6/c1-15-3-9-24(30(15)20-12-21(26(31)32)16(2)23(29)13-20)22-11-18(27)6-10-25(22)33-14-17-4-7-19(28)8-5-17;1-2/h3-13H,14,29H2,1-2H3,(H,31,32);1-2H3 |
| InChIKey | SPCDWPPUNQGYBE-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.45 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|