C25H16BrClF3NO3 — CID 58854340
5-[2-[5-bromo-2-[(2,4,6-trifluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-chlorobenzoic acid (PubChem CID 58854340) has the molecular formula C25H16BrClF3NO3 and a molecular weight of 550.76 g/mol. Its IUPAC name is 5-[2-[5-bromo-2-[(2,4,6-trifluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-chlorobenzoic acid.
| Compound Name | 5-[2-[5-bromo-2-[(2,4,6-trifluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 58854340 |
| Molecular Formula | C25H16BrClF3NO3 |
| Molecular Weight | 550.76 g/mol |
| Exact Mass | 549.00 |
| IUPAC Name | 5-[2-[5-bromo-2-[(2,4,6-trifluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-chlorobenzoic acid |
| SMILES | Cc1ccc(-c2cc(Br)ccc2OCc2c(F)cc(F)cc2F)n1-c1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C25H16BrClF3NO3/c1-13-2-6-23(31(13)16-4-5-20(27)17(11-16)25(32)33)18-8-14(26)3-7-24(18)34-12-19-21(29)9-15(28)10-22(19)30/h2-11H,12H2,1H3,(H,32,33) |
| InChIKey | CXGZNJLSGCHIIL-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.76 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|