C26H20ClF2NO3 — CID 58854417
5-[2-[5-chloro-2-[(2,3-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-methylbenzoic acid (PubChem CID 58854417) has the molecular formula C26H20ClF2NO3 and a molecular weight of 467.90 g/mol. Its IUPAC name is 5-[2-[5-chloro-2-[(2,3-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-methylbenzoic acid.
| Compound Name | 5-[2-[5-chloro-2-[(2,3-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 58854417 |
| Molecular Formula | C26H20ClF2NO3 |
| Molecular Weight | 467.90 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 5-[2-[5-chloro-2-[(2,3-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-methylbenzoic acid |
| SMILES | Cc1ccc(-n2c(C)ccc2-c2cc(Cl)ccc2OCc2cccc(F)c2F)cc1C(=O)O |
| InChI | InChI=1S/C26H20ClF2NO3/c1-15-6-9-19(13-20(15)26(31)32)30-16(2)7-10-23(30)21-12-18(27)8-11-24(21)33-14-17-4-3-5-22(28)25(17)29/h3-13H,14H2,1-2H3,(H,31,32) |
| InChIKey | JBPWGQBFSORFBU-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.90 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|