C25H19ClF2N2O3 — CID 10322418
3-amino-5-[2-[5-chloro-2-[(2,6-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]benzoic acid (PubChem CID 10322418) has the molecular formula C25H19ClF2N2O3 and a molecular weight of 468.89 g/mol. Its IUPAC name is 3-amino-5-[2-[5-chloro-2-[(2,6-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]benzoic acid.
| Compound Name | 3-amino-5-[2-[5-chloro-2-[(2,6-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 10322418 |
| Molecular Formula | C25H19ClF2N2O3 |
| Molecular Weight | 468.89 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 3-amino-5-[2-[5-chloro-2-[(2,6-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]benzoic acid |
| SMILES | Cc1ccc(-c2cc(Cl)ccc2OCc2c(F)cccc2F)n1-c1cc(N)cc(C(=O)O)c1 |
| InChI | InChI=1S/C25H19ClF2N2O3/c1-14-5-7-23(30(14)18-10-15(25(31)32)9-17(29)12-18)19-11-16(26)6-8-24(19)33-13-20-21(27)3-2-4-22(20)28/h2-12H,13,29H2,1H3,(H,31,32) |
| InChIKey | SBCDXIYHKBTKIZ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.89 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|