C24H18ClNO3 — CID 91584165
4-[2-(5-chloro-2-phenoxyphenyl)-5-methylpyrrol-1-yl]benzoic acid (PubChem CID 91584165) has the molecular formula C24H18ClNO3 and a molecular weight of 403.87 g/mol. Its IUPAC name is 4-[2-(5-chloro-2-phenoxyphenyl)-5-methylpyrrol-1-yl]benzoic acid.
| Compound Name | 4-[2-(5-chloro-2-phenoxyphenyl)-5-methylpyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 91584165 |
| Molecular Formula | C24H18ClNO3 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 4-[2-(5-chloro-2-phenoxyphenyl)-5-methylpyrrol-1-yl]benzoic acid |
| SMILES | Cc1ccc(-c2cc(Cl)ccc2Oc2ccccc2)n1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H18ClNO3/c1-16-7-13-22(26(16)19-11-8-17(9-12-19)24(27)28)21-15-18(25)10-14-23(21)29-20-5-3-2-4-6-20/h2-15H,1H3,(H,27,28) |
| InChIKey | DDPZKIUEFADOSQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|