C24H17ClF2N2O3 — CID 58854194
2-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]pyridine-4-carboxylic acid (PubChem CID 58854194) has the molecular formula C24H17ClF2N2O3 and a molecular weight of 454.86 g/mol. Its IUPAC name is 2-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]pyridine-4-carboxylic acid.
| Compound Name | 2-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 58854194 |
| Molecular Formula | C24H17ClF2N2O3 |
| Molecular Weight | 454.86 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 2-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]pyridine-4-carboxylic acid |
| SMILES | Cc1ccc(-c2cc(Cl)ccc2OCc2ccc(F)cc2F)n1-c1cc(C(=O)O)ccn1 |
| InChI | InChI=1S/C24H17ClF2N2O3/c1-14-2-6-21(29(14)23-10-15(24(30)31)8-9-28-23)19-11-17(25)4-7-22(19)32-13-16-3-5-18(26)12-20(16)27/h2-12H,13H2,1H3,(H,30,31) |
| InChIKey | MYMDHQOTMUEFQU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.86 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|