C26H20BrF2NO4 — CID 10459580
5-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-methoxybenzoic acid (PubChem CID 10459580) has the molecular formula C26H20BrF2NO4 and a molecular weight of 528.35 g/mol. Its IUPAC name is 5-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-methoxybenzoic acid.
| Compound Name | 5-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 10459580 |
| Molecular Formula | C26H20BrF2NO4 |
| Molecular Weight | 528.35 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | 5-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(-n2c(C)ccc2-c2cc(Br)ccc2OCc2ccc(F)cc2F)cc1C(=O)O |
| InChI | InChI=1S/C26H20BrF2NO4/c1-15-3-8-23(30(15)19-7-10-24(33-2)21(13-19)26(31)32)20-11-17(27)5-9-25(20)34-14-16-4-6-18(28)12-22(16)29/h3-13H,14H2,1-2H3,(H,31,32) |
| InChIKey | MYIPXSGTPKNZDQ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.35 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|