C33H33BrF2N2O5S — CID 142835444
3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-5-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoic acid;ethane;prop-1-yne (PubChem CID 142835444) has the molecular formula C33H33BrF2N2O5S and a molecular weight of 687.60 g/mol. Its IUPAC name is 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-5-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoic acid;ethane;prop-1-yne.
| Compound Name | 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-5-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoic acid;ethane;prop-1-yne |
|---|---|
| PubChem CID | 142835444 |
| Molecular Formula | C33H33BrF2N2O5S |
| Molecular Weight | 687.60 g/mol |
| Exact Mass | 686.13 |
| IUPAC Name | 3-[2-[5-bromo-2-[(2,4-difluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]-5-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoic acid;ethane;prop-1-yne |
| SMILES | C#CC.CC.Cc1ccc(-c2cc(Br)ccc2OCc2ccc(F)cc2F)n1-c1cc(C(=O)O)cc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C28H23BrF2N2O5S.C3H4.C2H6/c1-17-3-7-26(24-13-20(29)5-8-27(24)38-16-18-4-6-21(30)14-25(18)31)33(17)23-12-19(28(34)35)11-22(15-23)32-9-2-10-39(32,36)37;1-3-2;1-2/h3-8,11-15H,2,9-10,16H2,1H3,(H,34,35);1H,2H3;1-2H3 |
| InChIKey | HWMFRFWTGIXNNJ-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.60 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|