C25H18BrF3N2O3 — CID 58854435
3-amino-5-[2-[5-bromo-2-[(2,4,6-trifluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]benzoic acid (PubChem CID 58854435) has the molecular formula C25H18BrF3N2O3 and a molecular weight of 531.33 g/mol. Its IUPAC name is 3-amino-5-[2-[5-bromo-2-[(2,4,6-trifluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]benzoic acid.
| Compound Name | 3-amino-5-[2-[5-bromo-2-[(2,4,6-trifluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 58854435 |
| Molecular Formula | C25H18BrF3N2O3 |
| Molecular Weight | 531.33 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | 3-amino-5-[2-[5-bromo-2-[(2,4,6-trifluorophenyl)methoxy]phenyl]-5-methylpyrrol-1-yl]benzoic acid |
| SMILES | Cc1ccc(-c2cc(Br)ccc2OCc2c(F)cc(F)cc2F)n1-c1cc(N)cc(C(=O)O)c1 |
| InChI | InChI=1S/C25H18BrF3N2O3/c1-13-2-4-23(31(13)18-7-14(25(32)33)6-17(30)11-18)19-8-15(26)3-5-24(19)34-12-20-21(28)9-16(27)10-22(20)29/h2-11H,12,30H2,1H3,(H,32,33) |
| InChIKey | PTGYCLKTAUGOBI-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.33 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|