C28H22F5NO3 — CID 86611844
ethyl 2-[2-[2-[(2,4-difluorophenyl)methoxy]-5-(trifluoromethyl)phenyl]-5-methylpyrrol-1-yl]benzoate (PubChem CID 86611844) has the molecular formula C28H22F5NO3 and a molecular weight of 515.48 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(2,4-difluorophenyl)methoxy]-5-(trifluoromethyl)phenyl]-5-methylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 2-[2-[2-[(2,4-difluorophenyl)methoxy]-5-(trifluoromethyl)phenyl]-5-methylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 86611844 |
| Molecular Formula | C28H22F5NO3 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | ethyl 2-[2-[2-[(2,4-difluorophenyl)methoxy]-5-(trifluoromethyl)phenyl]-5-methylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1-n1c(C)ccc1-c1cc(C(F)(F)F)ccc1OCc1ccc(F)cc1F |
| InChI | InChI=1S/C28H22F5NO3/c1-3-36-27(35)21-6-4-5-7-24(21)34-17(2)8-12-25(34)22-14-19(28(31,32)33)10-13-26(22)37-16-18-9-11-20(29)15-23(18)30/h4-15H,3,16H2,1-2H3 |
| InChIKey | ZITIONFUUFDPFV-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|