C29H22F2N2O3 — CID 142835378
3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-hydroxyphenyl]-5-methylpyrrol-1-yl]naphthalene-1-carboxamide (PubChem CID 142835378) has the molecular formula C29H22F2N2O3 and a molecular weight of 484.50 g/mol. Its IUPAC name is 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-hydroxyphenyl]-5-methylpyrrol-1-yl]naphthalene-1-carboxamide.
| Compound Name | 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-hydroxyphenyl]-5-methylpyrrol-1-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 142835378 |
| Molecular Formula | C29H22F2N2O3 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-hydroxyphenyl]-5-methylpyrrol-1-yl]naphthalene-1-carboxamide |
| SMILES | Cc1ccc(-c2cc(O)ccc2OCc2ccc(F)cc2F)n1-c1cc(C(N)=O)c2ccccc2c1 |
| InChI | InChI=1S/C29H22F2N2O3/c1-17-6-10-27(33(17)21-12-18-4-2-3-5-23(18)24(14-21)29(32)35)25-15-22(34)9-11-28(25)36-16-19-7-8-20(30)13-26(19)31/h2-15,34H,16H2,1H3,(H2,32,35) |
| InChIKey | GKUGXQJBUMBLIR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|