C27H20ClO3- — CID 91900458
3-[2-(5-chloro-2-phenylmethoxyphenyl)-5-methylphenyl]benzoate (PubChem CID 91900458) has the molecular formula C27H20ClO3- and a molecular weight of 427.91 g/mol. Its IUPAC name is 3-[2-(5-chloro-2-phenylmethoxyphenyl)-5-methylphenyl]benzoate.
| Compound Name | 3-[2-(5-chloro-2-phenylmethoxyphenyl)-5-methylphenyl]benzoate |
|---|---|
| PubChem CID | 91900458 |
| Molecular Formula | C27H20ClO3- |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 3-[2-(5-chloro-2-phenylmethoxyphenyl)-5-methylphenyl]benzoate |
| SMILES | Cc1ccc(-c2cc(Cl)ccc2OCc2ccccc2)c(-c2cccc(C(=O)[O-])c2)c1 |
| InChI | InChI=1S/C27H21ClO3/c1-18-10-12-23(24(14-18)20-8-5-9-21(15-20)27(29)30)25-16-22(28)11-13-26(25)31-17-19-6-3-2-4-7-19/h2-16H,17H2,1H3,(H,29,30)/p-1 |
| InChIKey | XLNVLSJQTGVWNE-UHFFFAOYSA-M |
| XLogP | 5.92 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |