C19H13Cl3N2O3 — CID 11015392
benzyl 2-[3,5-dichloro-2-(3-chlorophenyl)-6-oxopyrazin-1-yl]acetate (PubChem CID 11015392) has the molecular formula C19H13Cl3N2O3 and a molecular weight of 423.68 g/mol. Its IUPAC name is benzyl 2-[3,5-dichloro-2-(3-chlorophenyl)-6-oxopyrazin-1-yl]acetate.
| Compound Name | benzyl 2-[3,5-dichloro-2-(3-chlorophenyl)-6-oxopyrazin-1-yl]acetate |
|---|---|
| PubChem CID | 11015392 |
| Molecular Formula | C19H13Cl3N2O3 |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | benzyl 2-[3,5-dichloro-2-(3-chlorophenyl)-6-oxopyrazin-1-yl]acetate |
| SMILES | O=C(Cn1c(-c2cccc(Cl)c2)c(Cl)nc(Cl)c1=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H13Cl3N2O3/c20-14-8-4-7-13(9-14)16-17(21)23-18(22)19(26)24(16)10-15(25)27-11-12-5-2-1-3-6-12/h1-9H,10-11H2 |
| InChIKey | NJSUKYPQAUCJHZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |