C27H23Cl2N3O3 — CID 11060264
benzyl 2-[3-chloro-2-(4-chlorophenyl)-6-oxo-5-(2-phenylethylamino)pyrazin-1-yl]acetate (PubChem CID 11060264) has the molecular formula C27H23Cl2N3O3 and a molecular weight of 508.41 g/mol. Its IUPAC name is benzyl 2-[3-chloro-2-(4-chlorophenyl)-6-oxo-5-(2-phenylethylamino)pyrazin-1-yl]acetate.
| Compound Name | benzyl 2-[3-chloro-2-(4-chlorophenyl)-6-oxo-5-(2-phenylethylamino)pyrazin-1-yl]acetate |
|---|---|
| PubChem CID | 11060264 |
| Molecular Formula | C27H23Cl2N3O3 |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | benzyl 2-[3-chloro-2-(4-chlorophenyl)-6-oxo-5-(2-phenylethylamino)pyrazin-1-yl]acetate |
| SMILES | O=C(Cn1c(-c2ccc(Cl)cc2)c(Cl)nc(NCCc2ccccc2)c1=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H23Cl2N3O3/c28-22-13-11-21(12-14-22)24-25(29)31-26(30-16-15-19-7-3-1-4-8-19)27(34)32(24)17-23(33)35-18-20-9-5-2-6-10-20/h1-14H,15-18H2,(H,30,31) |
| InChIKey | PZGMKAOHCFMXOY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |