C24H32ClN4O3+ — CID 18470942
benzyl 2-[3-chloro-5-[(1-cyclopentylpyrrolidin-1-ium-1-yl)methylamino]-2-methyl-6-oxopyrazin-1-yl]acetate (PubChem CID 18470942) has the molecular formula C24H32ClN4O3+ and a molecular weight of 460.00 g/mol. Its IUPAC name is benzyl 2-[3-chloro-5-[(1-cyclopentylpyrrolidin-1-ium-1-yl)methylamino]-2-methyl-6-oxopyrazin-1-yl]acetate.
| Compound Name | benzyl 2-[3-chloro-5-[(1-cyclopentylpyrrolidin-1-ium-1-yl)methylamino]-2-methyl-6-oxopyrazin-1-yl]acetate |
|---|---|
| PubChem CID | 18470942 |
| Molecular Formula | C24H32ClN4O3+ |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | benzyl 2-[3-chloro-5-[(1-cyclopentylpyrrolidin-1-ium-1-yl)methylamino]-2-methyl-6-oxopyrazin-1-yl]acetate |
| SMILES | Cc1c(Cl)nc(NC[N+]2(C3CCCC3)CCCC2)c(=O)n1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H32ClN4O3/c1-18-22(25)27-23(26-17-29(13-7-8-14-29)20-11-5-6-12-20)24(31)28(18)15-21(30)32-16-19-9-3-2-4-10-19/h2-4,9-10,20H,5-8,11-17H2,1H3,(H,26,27)/q+1 |
| InChIKey | OKWXAVSPLJVABC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|