C14H15ClN4O2 — CID 122212444
1-(4-benzyl-6-chloro-5-methyl-3-oxopyrazin-2-yl)-3-methylurea (PubChem CID 122212444) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is 1-(4-benzyl-6-chloro-5-methyl-3-oxopyrazin-2-yl)-3-methylurea.
| Compound Name | 1-(4-benzyl-6-chloro-5-methyl-3-oxopyrazin-2-yl)-3-methylurea |
|---|---|
| PubChem CID | 122212444 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-(4-benzyl-6-chloro-5-methyl-3-oxopyrazin-2-yl)-3-methylurea |
| SMILES | CNC(=O)Nc1nc(Cl)c(C)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C14H15ClN4O2/c1-9-11(15)17-12(18-14(21)16-2)13(20)19(9)8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3,(H2,16,17,18,21) |
| InChIKey | VONSENJYKLIAFF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |