C18H21ClN4O4 — CID 127045959
2-[2-benzyl-5-(tert-butylcarbamoylamino)-3-chloro-6-oxopyrazin-1-yl]acetic acid (PubChem CID 127045959) has the molecular formula C18H21ClN4O4 and a molecular weight of 392.84 g/mol. Its IUPAC name is 2-[2-benzyl-5-(tert-butylcarbamoylamino)-3-chloro-6-oxopyrazin-1-yl]acetic acid.
| Compound Name | 2-[2-benzyl-5-(tert-butylcarbamoylamino)-3-chloro-6-oxopyrazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 127045959 |
| Molecular Formula | C18H21ClN4O4 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-[2-benzyl-5-(tert-butylcarbamoylamino)-3-chloro-6-oxopyrazin-1-yl]acetic acid |
| SMILES | CC(C)(C)NC(=O)Nc1nc(Cl)c(Cc2ccccc2)n(CC(=O)O)c1=O |
| InChI | InChI=1S/C18H21ClN4O4/c1-18(2,3)22-17(27)21-15-16(26)23(10-13(24)25)12(14(19)20-15)9-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3,(H,24,25)(H2,20,21,22,27) |
| InChIKey | RBZQTFTVFUHCRF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |