C15H17ClN4O3 — CID 70066915
2-[2-chloro-3-ethyl-6-oxo-5-(2-pyridin-2-ylethylamino)pyrazin-1-yl]acetic acid (PubChem CID 70066915) has the molecular formula C15H17ClN4O3 and a molecular weight of 336.78 g/mol. Its IUPAC name is 2-[2-chloro-3-ethyl-6-oxo-5-(2-pyridin-2-ylethylamino)pyrazin-1-yl]acetic acid.
| Compound Name | 2-[2-chloro-3-ethyl-6-oxo-5-(2-pyridin-2-ylethylamino)pyrazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 70066915 |
| Molecular Formula | C15H17ClN4O3 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-[2-chloro-3-ethyl-6-oxo-5-(2-pyridin-2-ylethylamino)pyrazin-1-yl]acetic acid |
| SMILES | CCc1nc(NCCc2ccccn2)c(=O)n(CC(=O)O)c1Cl |
| InChI | InChI=1S/C15H17ClN4O3/c1-2-11-13(16)20(9-12(21)22)15(23)14(19-11)18-8-6-10-5-3-4-7-17-10/h3-5,7H,2,6,8-9H2,1H3,(H,18,19)(H,21,22) |
| InChIKey | PLAHGXWGFKNMAE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |