C22H25Cl2N5O — CID 70336650
6-chloro-1-[2-[2-(3-chloro-2-methylphenyl)ethylamino]ethyl]-3-(2-pyridin-2-ylethylamino)pyrazin-2-one (PubChem CID 70336650) has the molecular formula C22H25Cl2N5O and a molecular weight of 446.38 g/mol. Its IUPAC name is 6-chloro-1-[2-[2-(3-chloro-2-methylphenyl)ethylamino]ethyl]-3-(2-pyridin-2-ylethylamino)pyrazin-2-one.
| Compound Name | 6-chloro-1-[2-[2-(3-chloro-2-methylphenyl)ethylamino]ethyl]-3-(2-pyridin-2-ylethylamino)pyrazin-2-one |
|---|---|
| PubChem CID | 70336650 |
| Molecular Formula | C22H25Cl2N5O |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 6-chloro-1-[2-[2-(3-chloro-2-methylphenyl)ethylamino]ethyl]-3-(2-pyridin-2-ylethylamino)pyrazin-2-one |
| SMILES | Cc1c(Cl)cccc1CCNCCn1c(Cl)cnc(NCCc2ccccn2)c1=O |
| InChI | InChI=1S/C22H25Cl2N5O/c1-16-17(5-4-7-19(16)23)8-11-25-13-14-29-20(24)15-28-21(22(29)30)27-12-9-18-6-2-3-10-26-18/h2-7,10,15,25H,8-9,11-14H2,1H3,(H,27,28) |
| InChIKey | FTUOPSAIOWZQPI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|