C21H25ClN6O — CID 58869659
1-[2-[(3-chlorophenyl)methylamino]ethyl]-6-methyl-3-[2-(pyridin-2-ylamino)ethylamino]pyrazin-2-one (PubChem CID 58869659) has the molecular formula C21H25ClN6O and a molecular weight of 412.93 g/mol. Its IUPAC name is 1-[2-[(3-chlorophenyl)methylamino]ethyl]-6-methyl-3-[2-(pyridin-2-ylamino)ethylamino]pyrazin-2-one.
| Compound Name | 1-[2-[(3-chlorophenyl)methylamino]ethyl]-6-methyl-3-[2-(pyridin-2-ylamino)ethylamino]pyrazin-2-one |
|---|---|
| PubChem CID | 58869659 |
| Molecular Formula | C21H25ClN6O |
| Molecular Weight | 412.93 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1-[2-[(3-chlorophenyl)methylamino]ethyl]-6-methyl-3-[2-(pyridin-2-ylamino)ethylamino]pyrazin-2-one |
| SMILES | Cc1cnc(NCCNc2ccccn2)c(=O)n1CCNCc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H25ClN6O/c1-16-14-27-20(26-10-9-25-19-7-2-3-8-24-19)21(29)28(16)12-11-23-15-17-5-4-6-18(22)13-17/h2-8,13-14,23H,9-12,15H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | UYLDBSLZOPORNX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.93 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|