C26H25Cl2N5O — CID 11363911
6-chloro-1-[2-[[3-(3-chlorophenyl)phenyl]methylamino]ethyl]-3-(2-pyridin-2-ylethylamino)pyrazin-2-one (PubChem CID 11363911) has the molecular formula C26H25Cl2N5O and a molecular weight of 494.43 g/mol. Its IUPAC name is 6-chloro-1-[2-[[3-(3-chlorophenyl)phenyl]methylamino]ethyl]-3-(2-pyridin-2-ylethylamino)pyrazin-2-one.
| Compound Name | 6-chloro-1-[2-[[3-(3-chlorophenyl)phenyl]methylamino]ethyl]-3-(2-pyridin-2-ylethylamino)pyrazin-2-one |
|---|---|
| PubChem CID | 11363911 |
| Molecular Formula | C26H25Cl2N5O |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | 6-chloro-1-[2-[[3-(3-chlorophenyl)phenyl]methylamino]ethyl]-3-(2-pyridin-2-ylethylamino)pyrazin-2-one |
| SMILES | O=c1c(NCCc2ccccn2)ncc(Cl)n1CCNCc1cccc(-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C26H25Cl2N5O/c27-22-8-4-7-21(16-22)20-6-3-5-19(15-20)17-29-13-14-33-24(28)18-32-25(26(33)34)31-12-10-23-9-1-2-11-30-23/h1-9,11,15-16,18,29H,10,12-14,17H2,(H,31,32) |
| InChIKey | BXILLKBSXDXKFU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|