C17H13ClN2O2 — CID 142721290
2-chloro-3-(2-pyridin-2-ylethylamino)naphthalene-1,4-dione (PubChem CID 142721290) has the molecular formula C17H13ClN2O2 and a molecular weight of 312.76 g/mol. Its IUPAC name is 2-chloro-3-(2-pyridin-2-ylethylamino)naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-(2-pyridin-2-ylethylamino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 142721290 |
| Molecular Formula | C17H13ClN2O2 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-chloro-3-(2-pyridin-2-ylethylamino)naphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=C(NCCc2ccccn2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H13ClN2O2/c18-14-15(20-10-8-11-5-3-4-9-19-11)17(22)13-7-2-1-6-12(13)16(14)21/h1-7,9,20H,8,10H2 |
| InChIKey | CPIYKVKIOKPDLZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|