C10H9Cl2N5 — CID 58508167
4,6-dichloro-N-(2-pyridin-2-ylethyl)-1,3,5-triazin-2-amine (PubChem CID 58508167) has the molecular formula C10H9Cl2N5 and a molecular weight of 270.12 g/mol. Its IUPAC name is 4,6-dichloro-N-(2-pyridin-2-ylethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(2-pyridin-2-ylethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 58508167 |
| Molecular Formula | C10H9Cl2N5 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 4,6-dichloro-N-(2-pyridin-2-ylethyl)-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(Cl)nc(NCCc2ccccn2)n1 |
| InChI | InChI=1S/C10H9Cl2N5/c11-8-15-9(12)17-10(16-8)14-6-4-7-3-1-2-5-13-7/h1-3,5H,4,6H2,(H,14,15,16,17) |
| InChIKey | IIFXNFVXDRWGFL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |