C11H12N4 — CID 28544593
N-(2-pyridin-2-ylethyl)pyrazin-2-amine (PubChem CID 28544593) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is N-(2-pyridin-2-ylethyl)pyrazin-2-amine.
| Compound Name | N-(2-pyridin-2-ylethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 28544593 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | N-(2-pyridin-2-ylethyl)pyrazin-2-amine |
| SMILES | c1ccc(CCNc2cnccn2)nc1 |
| InChI | InChI=1S/C11H12N4/c1-2-5-13-10(3-1)4-6-14-11-9-12-7-8-15-11/h1-3,5,7-9H,4,6H2,(H,14,15) |
| InChIKey | GELGKMDPKCSVJZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |