C20H22BCuF4N4 — CID 139182393
1-N,2-N-bis(2-pyridin-2-ylethyl)benzene-1,2-diamine;copper(1+);tetrafluoroborate (PubChem CID 139182393) has the molecular formula C20H22BCuF4N4 and a molecular weight of 468.77 g/mol. Its IUPAC name is 1-N,2-N-bis(2-pyridin-2-ylethyl)benzene-1,2-diamine;copper(1+);tetrafluoroborate.
| Compound Name | 1-N,2-N-bis(2-pyridin-2-ylethyl)benzene-1,2-diamine;copper(1+);tetrafluoroborate |
|---|---|
| PubChem CID | 139182393 |
| Molecular Formula | C20H22BCuF4N4 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 1-N,2-N-bis(2-pyridin-2-ylethyl)benzene-1,2-diamine;copper(1+);tetrafluoroborate |
| SMILES | F[B-](F)(F)F.[Cu+].c1ccc(CCNc2ccccc2NCCc2ccccn2)nc1 |
| InChI | InChI=1S/C20H22N4.BF4.Cu/c1-2-10-20(24-16-12-18-8-4-6-14-22-18)19(9-1)23-15-11-17-7-3-5-13-21-17;2-1(3,4)5;/h1-10,13-14,23-24H,11-12,15-16H2;;/q;-1;+1 |
| InChIKey | OHYOXBDACTXDJJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|