C13H14BrN3 — CID 65343240
4-bromo-2-N-(2-pyridin-2-ylethyl)benzene-1,2-diamine (PubChem CID 65343240) has the molecular formula C13H14BrN3 and a molecular weight of 292.18 g/mol. Its IUPAC name is 4-bromo-2-N-(2-pyridin-2-ylethyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-(2-pyridin-2-ylethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 65343240 |
| Molecular Formula | C13H14BrN3 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 4-bromo-2-N-(2-pyridin-2-ylethyl)benzene-1,2-diamine |
| SMILES | Nc1ccc(Br)cc1NCCc1ccccn1 |
| InChI | InChI=1S/C13H14BrN3/c14-10-4-5-12(15)13(9-10)17-8-6-11-3-1-2-7-16-11/h1-5,7,9,17H,6,8,15H2 |
| InChIKey | MHVKYDSJSPBYTH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|