C12H14N4 — CID 28902053
4-N-(2-pyridin-2-ylethyl)pyridine-3,4-diamine (PubChem CID 28902053) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 4-N-(2-pyridin-2-ylethyl)pyridine-3,4-diamine.
| Compound Name | 4-N-(2-pyridin-2-ylethyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 28902053 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 4-N-(2-pyridin-2-ylethyl)pyridine-3,4-diamine |
| SMILES | Nc1cnccc1NCCc1ccccn1 |
| InChI | InChI=1S/C12H14N4/c13-11-9-14-7-5-12(11)16-8-4-10-3-1-2-6-15-10/h1-3,5-7,9H,4,8,13H2,(H,14,16) |
| InChIKey | VKCJBPZXYBEPAI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |