C13H15N3S — CID 114051759
4-N-(2-phenylsulfanylethyl)pyridine-3,4-diamine (PubChem CID 114051759) has the molecular formula C13H15N3S and a molecular weight of 245.35 g/mol. Its IUPAC name is 4-N-(2-phenylsulfanylethyl)pyridine-3,4-diamine.
| Compound Name | 4-N-(2-phenylsulfanylethyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 114051759 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 4-N-(2-phenylsulfanylethyl)pyridine-3,4-diamine |
| SMILES | Nc1cnccc1NCCSc1ccccc1 |
| InChI | InChI=1S/C13H15N3S/c14-12-10-15-7-6-13(12)16-8-9-17-11-4-2-1-3-5-11/h1-7,10H,8-9,14H2,(H,15,16) |
| InChIKey | KWWFLIWGOSFLCF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|