C11H15N3 — CID 106215733
4-N-hex-5-ynylpyridine-3,4-diamine (PubChem CID 106215733) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 4-N-hex-5-ynylpyridine-3,4-diamine.
| Compound Name | 4-N-hex-5-ynylpyridine-3,4-diamine |
|---|---|
| PubChem CID | 106215733 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 4-N-hex-5-ynylpyridine-3,4-diamine |
| SMILES | C#CCCCCNc1ccncc1N |
| InChI | InChI=1S/C11H15N3/c1-2-3-4-5-7-14-11-6-8-13-9-10(11)12/h1,6,8-9H,3-5,7,12H2,(H,13,14) |
| InChIKey | QVFCPDVHRFTHEJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|