C12H17N3 — CID 106215731
2-N-hex-5-ynyl-4-methylpyridine-2,3-diamine (PubChem CID 106215731) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-N-hex-5-ynyl-4-methylpyridine-2,3-diamine.
| Compound Name | 2-N-hex-5-ynyl-4-methylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 106215731 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2-N-hex-5-ynyl-4-methylpyridine-2,3-diamine |
| SMILES | C#CCCCCNc1nccc(C)c1N |
| InChI | InChI=1S/C12H17N3/c1-3-4-5-6-8-14-12-11(13)10(2)7-9-15-12/h1,7,9H,4-6,8,13H2,2H3,(H,14,15) |
| InChIKey | SBMFHZLBTKLISK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|