C10H14N4 — CID 106215719
3-N-hex-5-ynylpyridazine-3,6-diamine (PubChem CID 106215719) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-N-hex-5-ynylpyridazine-3,6-diamine.
| Compound Name | 3-N-hex-5-ynylpyridazine-3,6-diamine |
|---|---|
| PubChem CID | 106215719 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 3-N-hex-5-ynylpyridazine-3,6-diamine |
| SMILES | C#CCCCCNc1ccc(N)nn1 |
| InChI | InChI=1S/C10H14N4/c1-2-3-4-5-8-12-10-7-6-9(11)13-14-10/h1,6-7H,3-5,8H2,(H2,11,13)(H,12,14) |
| InChIKey | ZLEHIKLGOFMTKL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|