C10H16N4O — CID 106233945
5-[(3-amino-4-pyridinyl)amino]pentanamide (PubChem CID 106233945) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 5-[(3-amino-4-pyridinyl)amino]pentanamide.
| Compound Name | 5-[(3-amino-4-pyridinyl)amino]pentanamide |
|---|---|
| PubChem CID | 106233945 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 5-[(3-amino-4-pyridinyl)amino]pentanamide |
| SMILES | NC(=O)CCCCNc1ccncc1N |
| InChI | InChI=1S/C10H16N4O/c11-8-7-13-6-4-9(8)14-5-2-1-3-10(12)15/h4,6-7H,1-3,5,11H2,(H2,12,15)(H,13,14) |
| InChIKey | JZJORBKWKLGZTE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|