C9H14BrN3 — CID 104776649
N'-(3-bromo-4-pyridinyl)butane-1,4-diamine (PubChem CID 104776649) has the molecular formula C9H14BrN3 and a molecular weight of 244.14 g/mol. Its IUPAC name is N'-(3-bromo-4-pyridinyl)butane-1,4-diamine.
| Compound Name | N'-(3-bromo-4-pyridinyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 104776649 |
| Molecular Formula | C9H14BrN3 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | N'-(3-bromo-4-pyridinyl)butane-1,4-diamine |
| SMILES | NCCCCNc1ccncc1Br |
| InChI | InChI=1S/C9H14BrN3/c10-8-7-12-6-3-9(8)13-5-2-1-4-11/h3,6-7H,1-2,4-5,11H2,(H,12,13) |
| InChIKey | CIAIIHCRWHFEHW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|