C10H16BrN3O — CID 104777631
N'-(3-bromo-4-pyridinyl)-N-(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 104777631) has the molecular formula C10H16BrN3O and a molecular weight of 274.16 g/mol. Its IUPAC name is N'-(3-bromo-4-pyridinyl)-N-(2-methoxyethyl)ethane-1,2-diamine.
| Compound Name | N'-(3-bromo-4-pyridinyl)-N-(2-methoxyethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 104777631 |
| Molecular Formula | C10H16BrN3O |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | N'-(3-bromo-4-pyridinyl)-N-(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | COCCNCCNc1ccncc1Br |
| InChI | InChI=1S/C10H16BrN3O/c1-15-7-6-12-4-5-14-10-2-3-13-8-9(10)11/h2-3,8,12H,4-7H2,1H3,(H,13,14) |
| InChIKey | SRRMLQCPEQJGMJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|