C11H16BrN3O2 — CID 104777242
3-[(3-bromo-4-pyridinyl)amino]-N-(2-methoxyethyl)propanamide (PubChem CID 104777242) has the molecular formula C11H16BrN3O2 and a molecular weight of 302.17 g/mol. Its IUPAC name is 3-[(3-bromo-4-pyridinyl)amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[(3-bromo-4-pyridinyl)amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 104777242 |
| Molecular Formula | C11H16BrN3O2 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 3-[(3-bromo-4-pyridinyl)amino]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCNc1ccncc1Br |
| InChI | InChI=1S/C11H16BrN3O2/c1-17-7-6-15-11(16)3-5-14-10-2-4-13-8-9(10)12/h2,4,8H,3,5-7H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | SELZIOUHYNTIBK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|