C13H19N5O2 — CID 155958658
N-(2-methoxyethyl)-3-[(3-methylimidazo[4,5-c]pyridin-2-yl)amino]propanamide (PubChem CID 155958658) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[(3-methylimidazo[4,5-c]pyridin-2-yl)amino]propanamide.
| Compound Name | N-(2-methoxyethyl)-3-[(3-methylimidazo[4,5-c]pyridin-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 155958658 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-(2-methoxyethyl)-3-[(3-methylimidazo[4,5-c]pyridin-2-yl)amino]propanamide |
| SMILES | COCCNC(=O)CCNc1nc2ccncc2n1C |
| InChI | InChI=1S/C13H19N5O2/c1-18-11-9-14-5-3-10(11)17-13(18)16-6-4-12(19)15-7-8-20-2/h3,5,9H,4,6-8H2,1-2H3,(H,15,19)(H,16,17) |
| InChIKey | MBYGMEHZUJMKRH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|