C10H11N3O2 — CID 114793213
methyl 2-(3-methylimidazo[4,5-c]pyridin-2-yl)acetate (PubChem CID 114793213) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is methyl 2-(3-methylimidazo[4,5-c]pyridin-2-yl)acetate.
| Compound Name | methyl 2-(3-methylimidazo[4,5-c]pyridin-2-yl)acetate |
|---|---|
| PubChem CID | 114793213 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | methyl 2-(3-methylimidazo[4,5-c]pyridin-2-yl)acetate |
| SMILES | COC(=O)Cc1nc2ccncc2n1C |
| InChI | InChI=1S/C10H11N3O2/c1-13-8-6-11-4-3-7(8)12-9(13)5-10(14)15-2/h3-4,6H,5H2,1-2H3 |
| InChIKey | UPTAFCQGRCDGRV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |