About 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine
4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine (PubChem CID 18694804) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine.
Molecular Properties
| Compound Name | 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine |
| PubChem CID | 18694804 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine |
| SMILES | Cn1c(CCCCN)nc2ccncc21 |
| InChI | InChI=1S/C11H16N4/c1-15-10-8-13-7-5-9(10)14-11(15)4-2-3-6-12/h5,7-8H,2-4,6,12H2,1H3 |
| InChIKey | RBNMANOOGSWREI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine?
The IUPAC name of 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine (CID 18694804) is 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine.
What is the SMILES notation for 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine?
The canonical SMILES for 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine is Cn1c(CCCCN)nc2ccncc21.
What is the InChIKey of 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine?
The InChIKey is RBNMANOOGSWREI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4/c1-15-10-8-13-7-5-9(10)14-11(15)4-2-3-6-12/h5,7-8H,2-4,6,12H2,1H3.
What are the key properties of 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine?
4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine has a molecular weight of 204.28 g/mol, XLogP of 1.25, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine is sourced from PubChem (CID 18694804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).