C11H16N4 — CID 18694804
4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine (PubChem CID 18694804) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine.
| Compound Name | 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 18694804 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 4-(3-methylimidazo[4,5-c]pyridin-2-yl)butan-1-amine |
| SMILES | Cn1c(CCCCN)nc2ccncc21 |
| InChI | InChI=1S/C11H16N4/c1-15-10-8-13-7-5-9(10)14-11(15)4-2-3-6-12/h5,7-8H,2-4,6,12H2,1H3 |
| InChIKey | RBNMANOOGSWREI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|